Diiodotyrosine
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m |
|||
(2 intermediate revisions not shown.) | |||
Line 1: | Line 1: | ||
- | |||
- | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
- | == | + | |
+ | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1050&show=SHOW-3D Show 3-D Structure] | ||
+ | {{Drugbox | ||
+ | | IUPAC_name = (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid | ||
+ | | CAS_number = 66-02-4 | ||
+ | | CAS_supplemental = | ||
+ | | ATC_suffix = | ||
+ | | ATC_supplemental = | ||
+ | | PubChem = 9305 | ||
+ | | ChemSpiderID = | ||
+ | | chemical_formula =C<sub>9</sub>H<sub>9</sub>I<sub>2</sub>NO<sub>3</sub> | ||
+ | | molecular_weight = 432.98 | ||
+ | | smiles = C1=C(C=C(C(=C1I)O)I)CC(C(=O)O)N | ||
+ | | synonyms = L-Diiodotyrosine | ||
+ | | density = | ||
+ | | melting_point = | ||
+ | | boiling_point = | ||
+ | | solubility = 617(EXP) at 25<sup>o</sup>C | ||
+ | | specific_rotation = | ||
+ | | sec_combustion = | ||
+ | | bioavailability = | ||
+ | | protein_bound = | ||
+ | | metabolism = | ||
+ | | elimination_half-life = | ||
+ | | excretion = | ||
+ | | pregnancy_category= | ||
+ | | dependency_liability = | ||
+ | | routes_of_administration = | ||
+ | }} | ||
A product from the iodination of MONOIODOTYROSINE. In the biosynthesis of thyroid hormones, diiodotyrosine residues are coupled with other monoiodotyrosine or diiodotyrosine residues to form T4 or T3 thyroid hormones (THYROXINE and TRIIODOTHYRONINE). | A product from the iodination of MONOIODOTYROSINE. In the biosynthesis of thyroid hormones, diiodotyrosine residues are coupled with other monoiodotyrosine or diiodotyrosine residues to form T4 or T3 thyroid hormones (THYROXINE and TRIIODOTHYRONINE). | ||
==General Properties== | ==General Properties== | ||
Line 56: | Line 82: | ||
- | [[ | + | [[Category:Hormones]] |
Current revision
|
Diiodotyrosine
| |
Systematic (IUPAC) name | |
(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid | |
Identifiers | |
CAS number | |
ATC code | ? |
PubChem | |
Chemical data | |
Formula | C9H9I2NO3 |
Mol. mass | 432.98 |
SMILES | & |
Synonyms | L-Diiodotyrosine |
Physical data | |
Solubility in water | 617(EXP) at 25oC mg/mL |
Pharmacokinetic data | |
Bioavailability | ? |
Metabolism | ? |
Half life | ? |
Excretion | ? |
Therapeutic considerations | |
Pregnancy cat. |
? |
Legal status | |
Routes | ? |
A product from the iodination of MONOIODOTYROSINE. In the biosynthesis of thyroid hormones, diiodotyrosine residues are coupled with other monoiodotyrosine or diiodotyrosine residues to form T4 or T3 thyroid hormones (THYROXINE and TRIIODOTHYRONINE).
[edit] General Properties
*Molecular Weight
432.98
*Molecular Formula
C9H9I2NO3
*IUPAC NAME
(2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid
*Canonical Smiles
C1=C(C=C(C(=C1I)O)I)CC(C(=O)O)N
*Isomeric Smiles
C1=C(C=C(C(=C1I)O)I)C[C@@H](C(=O)O)N
[edit] PhysioChemical Properties
*Melting Point
*LogP
0.57(EST)
*Water Solubility
617(EXP) at 25C