Dienestrol
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m |
|||
(2 intermediate revisions not shown.) | |||
Line 1: | Line 1: | ||
- | |||
- | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
- | == | + | |
+ | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1045&show=SHOW-3D Show 3-D Structure] | ||
+ | {{Drugbox | ||
+ | | IUPAC_name = 4-[(2E,4E)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol | ||
+ | | CAS_number = 84-17-3 | ||
+ | | CAS_supplemental = | ||
+ | | ATC_suffix = | ||
+ | | ATC_supplemental = | ||
+ | | PubChem = 667476 | ||
+ | | ChemSpiderID = | ||
+ | | DrugBank = APRD00917 | ||
+ | | chemical_formula =C<sub>1</sub><sub>8</sub>H<sub>1</sub><sub>8</sub>O<sub>2</sub> | ||
+ | | molecular_weight = 266.33 | ||
+ | | smiles = CC=C(C1=CC=C(C=C1)O)C(=CC)C2=CC=C(C=C2)O | ||
+ | | synonyms = alpha-Dienestrol | ||
+ | | density = | ||
+ | | melting_point = 227.5(EXP) | ||
+ | | boiling_point = | ||
+ | | solubility = 3(EXP) at 37<sup>o</sup>C | ||
+ | | specific_rotation = | ||
+ | | sec_combustion = | ||
+ | | bioavailability = | ||
+ | | protein_bound = 50 to 80% | ||
+ | | metabolism = | ||
+ | | elimination_half-life = | ||
+ | | excretion = | ||
+ | | pregnancy_category= | ||
+ | | dependency_liability = | ||
+ | | routes_of_administration = | ||
+ | }} | ||
A synthetic, non-steroidal estrogen structurally related to stilbestrol. It is used, usually as the cream, in the treatment of menopausal and postmenopausal symptoms. | A synthetic, non-steroidal estrogen structurally related to stilbestrol. It is used, usually as the cream, in the treatment of menopausal and postmenopausal symptoms. | ||
==General Properties== | ==General Properties== | ||
Line 56: | Line 83: | ||
*[http://www.drugbank.ca/drugs/DB00890]Drugbank | *[http://www.drugbank.ca/drugs/DB00890]Drugbank | ||
- | [[ | + | [[Category:Hormones]] |
Current revision
|
Dienestrol
| |
Systematic (IUPAC) name | |
4-[(2E,4E)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol | |
Identifiers | |
CAS number | |
ATC code | ? |
PubChem | |
DrugBank | |
Chemical data | |
Formula | C18H18O2 |
Mol. mass | 266.33 |
SMILES | & |
Synonyms | alpha-Dienestrol |
Physical data | |
Melt. point | 227.5(EXP) °C |
Solubility in water | 3(EXP) at 37oC mg/mL |
Pharmacokinetic data | |
Bioavailability | ? |
Protein binding | 50 to 80% |
Metabolism | ? |
Half life | ? |
Excretion | ? |
Therapeutic considerations | |
Pregnancy cat. |
? |
Legal status | |
Routes | ? |
A synthetic, non-steroidal estrogen structurally related to stilbestrol. It is used, usually as the cream, in the treatment of menopausal and postmenopausal symptoms.
[edit] General Properties
*Molecular Weight
266.33
*Molecular Formula
C18H18O2
*IUPAC NAME
4-[(2E,4E)-4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol
*Canonical Smiles
CC=C(C1=CC=C(C=C1)O)C(=CC)C2=CC=C(C=C2)O
*Isomeric Smiles
CC=C(/C1=CC=C(C=C1)O)C(=CC)C2=CC=C(C=C2)O
[edit] PhysioChemical Properties
*Melting Point
227.5(EXP)
*LogP
5.32(EST)
*Water Solubility
3(EXP) at 37C