Leukotriene C4

From DrugPedia: A Wikipedia for Drug discovery

(Difference between revisions)
Jump to: navigation, search
Line 12: Line 12:
{{Drugbox
{{Drugbox
-
| IUPAC_name =
+
| IUPAC_name = (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-[[(4S)-4-amino-5-hydroxy-5-oxopentanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic  acid
| CAS_number        =
| CAS_number        =
| CAS_supplemental  =
| CAS_supplemental  =

Revision as of 11:14, 20 February 2009

Show 3-D Structure

{{Drugbox | IUPAC_name = (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-[[(4S)-4-amino-5-hydroxy-5-oxopentanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid | CAS_number = | CAS_supplemental = | ATC_suffix = | ATC_supplemental = | PubChem = | DrugBank = | ChemSpiderID = | chemical_formula = | molecular_weight = | smiles = | synonyms = | density = | melting_point = | boiling_point = | solubility = | specific_rotation = | sec_combustion = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category= | dependency_liability = | routes_of_administration = }}


The conjugation product of LEUKOTRIENE A4 and glutathione. It is the major arachidonic acid metabolite in macrophages and human mast cells as well as in antigen-sensitized lung tissue. It stimulates mucus secretion in the lung, and produces contractions of nonvascular and some VASCULAR SMOOTH MUSCLE. (From Dictionary of Prostaglandins and Related Compounds, 1990)

General Properties

*Molecular Weight

625.77

*Molecular Formula

C30H47N3O9S

*IUPAC NAME

(5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-[[(4S)-4-amino-5-hydroxy-5-oxopentanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid

*Canonical Smiles

CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N

*Isomeric Smiles

CCCCCC=C/CC=C/C=C/C=C/[C@H]([C@H](CCCC(=O)O)O)SC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N


PhysioChemical Properties

*Melting Point


*LogP


*Water Solubility


External Links

  • [1]Pubchem
  • [2]KEGG Compound
  • [3]Human Metabolome DataBase


Categories:Hormones