DHEA sulfate
From DrugPedia: A Wikipedia for Drug discovery
| Line 9: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| - | |||
| - | |||
| - | The circulating form of a major C19 steroid produced primarily by the ADRENAL CORTEX. DHEA sulfate serves as a precursor for TESTOSTERONE; ANDROSTENEDIONE; ESTRADIOL; and ESTRONE. | + | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1044&show=SHOW-3D Show 3-D Structure] |
| + | {{Drugbox | ||
| + | | IUPAC_name = [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate | ||
| + | | CAS_number = 651-48-9 | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 12594 | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula =C<sub>1</sub><sub>9</sub>H<sub>2</sub><sub>8</sub>O<sub>5</sub>S | ||
| + | | molecular_weight = 368.49 | ||
| + | | smiles = C1C(C(C(=O)O1)CC2=CC(=CC=C2)O)CC3=CC(=CC=C3)O | ||
| + | | synonyms = Dehydroepiandrosterone Sulfate | ||
| + | | density = | ||
| + | | melting_point = | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
| + | The circulating form of a major C19 steroid produced primarily by the ADRENAL CORTEX. DHEA sulfate serves as a precursor for TESTOSTERONE; ANDROSTENEDIONE; ESTRADIOL; and ESTRONE.'''Dehydroepiandrosterone sulfate''' or '''DHEA sulfate''' is a [[metabolite]] of [[dehydroepiandrosterone]] (DHEA) produced by the addition of a sulfate group, [[catalyst|catalyzed]] by the [[sulfotransferase]] [[enzyme]]s [[SULT1A1]] and [[SULT1E1]], which also produce [[estrone sulfate]] from [[estrone]]. DHEA sulfate can also be back-converted to DHEA through the action of [[steroid sulfatase]]. | ||
| + | |||
| + | DHEA sulfate levels decline as a person ages. | ||
==General Properties== | ==General Properties== | ||
| Line 34: | Line 62: | ||
C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C | ||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| Line 56: | Line 70: | ||
| - | [[ | + | [[Category:Hormones]] |
| + | [[Category:Metabolism]] | ||
| + | [[Category:Organosulfates]] | ||
| + | [[Category:Steroids]] | ||
Current revision
|
|
| DHEA sulfate
| |
| Systematic (IUPAC) name | |
| [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate | |
| Identifiers | |
| CAS number | |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C19H28O5S |
| Mol. mass | 368.49 |
| SMILES | & |
| Synonyms | Dehydroepiandrosterone Sulfate |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
The circulating form of a major C19 steroid produced primarily by the ADRENAL CORTEX. DHEA sulfate serves as a precursor for TESTOSTERONE; ANDROSTENEDIONE; ESTRADIOL; and ESTRONE.Dehydroepiandrosterone sulfate or DHEA sulfate is a metabolite of dehydroepiandrosterone (DHEA) produced by the addition of a sulfate group, catalyzed by the sulfotransferase enzymes SULT1A1 and SULT1E1, which also produce estrone sulfate from estrone. DHEA sulfate can also be back-converted to DHEA through the action of steroid sulfatase.
DHEA sulfate levels decline as a person ages.
[edit] General Properties
*Molecular Weight
368.49
*Molecular Formula
C19H28O5S
*IUPAC NAME
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate
*Canonical Smiles
CC12CCC3C(C1CCC2=O)CC=C4C3(CCC(C4)OS(=O)(=O)O)C
*Isomeric Smiles
C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C
