2-arachidonylglycerol
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
(→Description) |
|||
| Line 8: | Line 8: | ||
</td></tr></table> | </td></tr></table> | ||
| + | {{Drugbox | ||
| + | | IUPAC_name = 1,3-dihydroxypropan-2-yl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate | ||
| + | | CAS_number = | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = BA03 | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 123917 | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula =C<sub>2</sub><sub>3</sub>H<sub>3</sub><sub>8</sub>O<sub>4</sub> | ||
| + | | molecular_weight = 378.55 | ||
| + | | smiles = CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(CO)CO | ||
| + | | synonyms = 2-AG | ||
| + | | density = | ||
| + | | melting_point = | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
| + | [http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1002&show=SHOW-3D Show 3-D Structure] | ||
| + | |||
==Description== | ==Description== | ||
binds to cannabinoid receptors; structure in first source | binds to cannabinoid receptors; structure in first source | ||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
Revision as of 09:15, 19 February 2009
|
|
| 2-arachidonylglycerol
| |
| Systematic (IUPAC) name | |
| 1,3-dihydroxypropan-2-yl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C23H38O4 |
| Mol. mass | 378.55 |
| SMILES | & |
| Synonyms | 2-AG |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
Description
binds to cannabinoid receptors; structure in first source
