From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m |
m |
| Line 1: |
Line 1: |
| | + | '''Pregnanediol''' |
| | + | Pubchem(3032822) |
| | | | |
| | + | An inactive metabolite of PROGESTERONE by reduction at C5, C3, and C20 position. Pregnanediol has two hydroxyl groups, at 3-alpha and 20-alpha. It is detectable in URINE after OVULATION and is found in great quantities in the pregnancy urine. |
| | | | |
| - | <table align='right' border=1>
| + | '''KEGG Pathway'''(C05484,D00189) |
| - | <tr><td>
| + | *C21-Steroid hormone metabolism |
| - | <jmol><jmolApplet>
| + | |
| - | <size>200</size>
| + | |
| - | <script>spin on;color atoms amino;</script>
| + | |
| - | <uploadedFileContents>NPH205.SDF</uploadedFileContents>
| + | |
| - | <color>black</color>
| + | |
| - | </jmolApplet>
| + | |
| - | </jmol>
| + | |
| - | </td></tr></table>
| + | |
| - | ==Description==
| + | |
| - | An inactive metabolite of PROGESTERONE by reduction at C5, C3, and C20 position. Pregnanediol has two hydroxyl groups, at 3-alpha and 20-alpha. It is detectable in URINE after OVULATION and is found in great quantities in the pregnancy urine.
| + | |
| - | ==General Properties==
| + | |
| - | | + | |
| - | <b>*Molecular Weight</b>
| + | |
| - | | + | |
| - | 320.51
| + | |
| - | | + | |
| - | <b>*Molecular Formula</b>
| + | |
| - | | + | |
| - | C<sub>2</sub><sub>1</sub>H<sub>3</sub><sub>6</sub>O<sub>2</sub>
| + | |
| - | | + | |
| - | <b>*IUPAC NAME</b>
| + | |
| - | | + | |
| - | (8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,3-diol | + | |
| - | | + | |
| - | <b>*Canonical Smiles</b>
| + | |
| - | | + | |
| - | CCC1CCC2C1(CCC3C2CCC4C3(CCC(C4)(O)O)C)C
| + | |
| - | | + | |
| - | <b>*Isomeric Smiles</b>
| + | |
| - | | + | |
| - | CC[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4[C@@]3(CCC(C4)(O)O)C)C
| + | |
| - | | + | |
| - | | + | |
| - | ==PhysioChemical Properties==
| + | |
| - | | + | |
| - | <b>*Melting Point</b>
| + | |
| - | | + | |
| - | | + | |
| - | | + | |
| - | <b>*LogP</b>
| + | |
| - | | + | |
| - | | + | |
| - | | + | |
| - | <b>*Water Solubility</b>
| + | |
| - | | + | |
| - | | + | |
| - | | + | |
| - | ==External Links==
| + | |
| - | *[http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3032822]Pubchem
| + | |
| - | *[http://www.genome.jp/dbget-bin/www_bget?compound+C05484]KEGG Compound
| + | |
| - | *[http://www.genome.jp/dbget-bin/www_bget?drug+D00189 ]KEGG Drug
| + | |
| - | *[http://www.hmdb.ca/metabolites/HMDB04025]Human Metabolome DataBase
| + | |
| - | | + | |
| - | | + | |
| - | [[Categories:Hormones]]
| + | |
Revision as of 07:12, 13 February 2009
Pregnanediol
Pubchem(3032822)
An inactive metabolite of PROGESTERONE by reduction at C5, C3, and C20 position. Pregnanediol has two hydroxyl groups, at 3-alpha and 20-alpha. It is detectable in URINE after OVULATION and is found in great quantities in the pregnancy urine.
KEGG Pathway(C05484,D00189)
- C21-Steroid hormone metabolism
