Algestone Acetophenide
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
| Line 9: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| - | == | + | {{Drugbox |
| + | | IUPAC_name = | ||
| + | | CAS_number = | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = BA03 | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 32327 | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula =C<sub>2</sub><sub>9</sub>H<sub>3</sub><sub>6</sub>O<sub>4</sub> | ||
| + | | molecular_weight = 448.59 | ||
| + | | smiles = CC(=O)C12C(CC3C1(CCC4C3CCC5=CC(=O)CCC45C)C)OC(O2)(C)C6=CC=CC=C6 | ||
| + | | synonyms = Deladroxone | ||
| + | | density = | ||
| + | | melting_point = 150.5(EXP) | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
[http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1012&show=SHOW-3D Show 3-D Structure] | [http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1012&show=SHOW-3D Show 3-D Structure] | ||
| - | + | ==Description== | |
A progesterone that has been used in ESTRUS SYNCHRONIZATION and has been evaluated as an injectable contraceptive in combination with estradiol enanthate. It is also used therapeutically as a topical anti-inflammatory and is applied topically in the treatment of ACNE. | A progesterone that has been used in ESTRUS SYNCHRONIZATION and has been evaluated as an injectable contraceptive in combination with estradiol enanthate. It is also used therapeutically as a topical anti-inflammatory and is applied topically in the treatment of ACNE. | ||
==General Properties== | ==General Properties== | ||
Revision as of 11:57, 19 February 2009
|
|
| Algestone Acetophenide
| |
| Systematic (IUPAC) name | |
| ? | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C29H36O4 |
| Mol. mass | 448.59 |
| SMILES | & |
| Synonyms | Deladroxone |
| Physical data | |
| Melt. point | 150.5(EXP) °C |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
Contents |
Description
A progesterone that has been used in ESTRUS SYNCHRONIZATION and has been evaluated as an injectable contraceptive in combination with estradiol enanthate. It is also used therapeutically as a topical anti-inflammatory and is applied topically in the treatment of ACNE.
General Properties
*Molecular Weight
448.59
*Molecular Formula
C29H36O4
*IUPAC NAME
*Canonical Smiles
CC(=O)C12C(CC3C1(CCC4C3CCC5=CC(=O)CCC45C)C)OC(O2)(C)C6=CC=CC=C6
*Isomeric Smiles
CC(=O)[C@@]12[C@@H](C[C@@H]3C1(CC[C@H]4C3CCC5=CC(=O)CCC45C)C)OC(O2)(C)C6=CC=CC=C6
PhysioChemical Properties
*Melting Point
150.5(EXP)
*LogP
5.53(EST)
*Water Solubility
External Links
- [1]Pubchem
