20-alpha-Dihydroprogesterone
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
(→Description) |
|||
| Line 1: | Line 1: | ||
| - | |||
| - | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
| Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| + | {{Drugbox | ||
| + | | IUPAC_name = (8S,9S,10R,13S,14S,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopent[a]phenanthren-3-one | ||
| + | | CAS_number = 145-14-2 | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = BA03 | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 8956 | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula =C<sub>2</sub><sub>1</sub>H<sub>3</sub><sub>2</sub>O<sub>2</sub> | ||
| + | | molecular_weight = 316.48 | ||
| + | | smiles = CC(C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O | ||
| + | | synonyms = Dihydroprognenolone | ||
| + | | density = | ||
| + | | melting_point = | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
| + | [http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1008&show=SHOW-3D Show 3-D Structure] | ||
==Description== | ==Description== | ||
A biologically active 20-alpha-reduced metabolite of PROGESTERONE. It is converted from progesterone to 20-alpha-hydroxypregn-4-en-3-one by the 20-ALPHA-HYDROXYSTEROID DEHYDROGENASE in the CORPUS LUTEUM and the PLACENTA. | A biologically active 20-alpha-reduced metabolite of PROGESTERONE. It is converted from progesterone to 20-alpha-hydroxypregn-4-en-3-one by the 20-ALPHA-HYDROXYSTEROID DEHYDROGENASE in the CORPUS LUTEUM and the PLACENTA. | ||
| - | + | ||
==General Properties== | ==General Properties== | ||
| Line 36: | Line 62: | ||
C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O | ||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| Line 59: | Line 71: | ||
| - | [[ | + | [[Category:Hormones]] |
Current revision
|
|
| 20-alpha-Dihydroprogesterone
| |
| Systematic (IUPAC) name | |
| (8S,9S,10R,13S,14S,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopent[a]phenanthren-3-one | |
| Identifiers | |
| CAS number | |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C21H32O2 |
| Mol. mass | 316.48 |
| SMILES | & |
| Synonyms | Dihydroprognenolone |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
[edit] Description
A biologically active 20-alpha-reduced metabolite of PROGESTERONE. It is converted from progesterone to 20-alpha-hydroxypregn-4-en-3-one by the 20-ALPHA-HYDROXYSTEROID DEHYDROGENASE in the CORPUS LUTEUM and the PLACENTA.
[edit] General Properties
*Molecular Weight
316.48
*Molecular Formula
C21H32O2
*IUPAC NAME
(8S,9S,10R,13S,14S,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
*Canonical Smiles
CC(C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O
*Isomeric Smiles
C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O
