5S-HpETE
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
(New page: 5S-HpETE Pubchem(5280778) 5-HPETE is used inconsistently in literature as syn for cpds with various tetraene locants; RN given refers to (6,8,11,14)-isomer; RN in CA Vol 91 Form Index for...) |
m |
||
| Line 1: | Line 1: | ||
| - | |||
| - | |||
| - | |||
| - | '' | + | <table align='right' border=1> |
| - | * | + | <tr><td> |
| - | * | + | <jmol><jmolApplet> |
| + | <size>200</size> | ||
| + | <script>spin on;color atoms amino;</script> | ||
| + | <uploadedFileContents>NPH443.SDF</uploadedFileContents> | ||
| + | <color>black</color> | ||
| + | </jmolApplet> | ||
| + | </jmol> | ||
| + | </td></tr></table> | ||
| + | ==Description== | ||
| + | 5-HPETE is used inconsistently in literature as syn for cpds with various tetraene locants; RN given refers to (6,8,11,14)-isomer; RN in CA Vol 91 Form Index for (E,Z,Z,Z)-isomer: 70968-82-0; RN for (5,8,11,13)-isomer: 71133-12-5; in Merck, arachidonic acid is the (5,8,11,14)-isomer | ||
| + | ==General Properties== | ||
| + | |||
| + | <b>*Molecular Weight</b> | ||
| + | |||
| + | 336.47 | ||
| + | |||
| + | <b>*Molecular Formula</b> | ||
| + | |||
| + | C<sub>2</sub><sub>0</sub>H<sub>3</sub><sub>2</sub>O<sub>4</sub> | ||
| + | |||
| + | <b>*IUPAC NAME</b> | ||
| + | |||
| + | (5S,6E,8Z,11Z,14Z)-5-hydroperoxyicosa-6,8,11,14-tetraenoic acid | ||
| + | |||
| + | <b>*Canonical Smiles</b> | ||
| + | |||
| + | CCCCCC=CCC=CCC=CC=CC(CCCC(=O)O)OO | ||
| + | |||
| + | <b>*Isomeric Smiles</b> | ||
| + | |||
| + | CCCCCC=C/CC=C/CC=C/C=C/[C@H](CCCC(=O)O)OO | ||
| + | |||
| + | |||
| + | ==PhysioChemical Properties== | ||
| + | |||
| + | <b>*Melting Point</b> | ||
| + | |||
| + | |||
| + | |||
| + | <b>*LogP</b> | ||
| + | |||
| + | |||
| + | |||
| + | <b>*Water Solubility</b> | ||
| + | |||
| + | |||
| + | |||
| + | ==External Links== | ||
| + | *[http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280778]Pubchem | ||
| + | *[http://www.genome.jp/dbget-bin/www_bget?compound+C05356]KEGG Compound | ||
| + | *[http://www.hmdb.ca/metabolites/HMDB01193]Human Metabolome DataBase | ||
| + | |||
| + | |||
| + | [[Categories:Hormones]] | ||
Revision as of 00:00, 15 January 2001
|
|
Contents |
Description
5-HPETE is used inconsistently in literature as syn for cpds with various tetraene locants; RN given refers to (6,8,11,14)-isomer; RN in CA Vol 91 Form Index for (E,Z,Z,Z)-isomer: 70968-82-0; RN for (5,8,11,13)-isomer: 71133-12-5; in Merck, arachidonic acid is the (5,8,11,14)-isomer
General Properties
*Molecular Weight
336.47
*Molecular Formula
C20H32O4
*IUPAC NAME
(5S,6E,8Z,11Z,14Z)-5-hydroperoxyicosa-6,8,11,14-tetraenoic acid
*Canonical Smiles
CCCCCC=CCC=CCC=CC=CC(CCCC(=O)O)OO
*Isomeric Smiles
CCCCCC=C/CC=C/CC=C/C=C/[C@H](CCCC(=O)O)OO
PhysioChemical Properties
*Melting Point
*LogP
*Water Solubility
