Equilenin
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
(One intermediate revision not shown.) | |||
Line 9: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
- | |||
- | |||
+ | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1057&show=SHOW-3D Show 3-D Structure] | ||
+ | {{Drugbox | ||
+ | | IUPAC_name =(13S,14S)-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one | ||
+ | | CAS_number = 517-09-9 | ||
+ | | CAS_supplemental = | ||
+ | | ATC_suffix = | ||
+ | | ATC_supplemental = | ||
+ | | PubChem = 444865 | ||
+ | | ChemSpiderID = | ||
+ | | DrugBank = EXPT01356 | ||
+ | | chemical_formula =C<sub>1</sub><sub>8</sub>H<sub>1</sub><sub>8</sub>O<sub>2</sub> | ||
+ | | molecular_weight = 266.33 | ||
+ | | smiles = CC12CCC3=C(C1CCC2=O)C=CC4=C3C=CC(=C4)O | ||
+ | | synonyms = 3-Hydroxy-1,3,5(10),6,8-estrapentaen-17-one | ||
+ | | density = | ||
+ | | melting_point = | ||
+ | | boiling_point = | ||
+ | | solubility = | ||
+ | | specific_rotation = | ||
+ | | sec_combustion = | ||
+ | | bioavailability = | ||
+ | | protein_bound = | ||
+ | | metabolism = | ||
+ | | elimination_half-life = | ||
+ | | excretion = | ||
+ | | pregnancy_category= | ||
+ | | dependency_liability = | ||
+ | | routes_of_administration = | ||
+ | }} | ||
An estrogenic steroid produced by HORSES. It has a total of five double bonds in the A- and B-ring. High concentration of equilenin is found in the URINE of pregnant mares. | An estrogenic steroid produced by HORSES. It has a total of five double bonds in the A- and B-ring. High concentration of equilenin is found in the URINE of pregnant mares. | ||
==General Properties== | ==General Properties== | ||
Line 34: | Line 61: | ||
C[C@]12CCC3=C([C@@H]1CCC2=O)C=CC4=C3C=CC(=C4)O | C[C@]12CCC3=C([C@@H]1CCC2=O)C=CC4=C3C=CC(=C4)O | ||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
Line 56: | Line 69: | ||
- | [[ | + | [[Category:Hormones]] |
+ | [[Category:HMRbase]] |
Current revision
|
Equilenin
| |
Systematic (IUPAC) name | |
(13S,14S)-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one | |
Identifiers | |
CAS number | |
ATC code | ? |
PubChem | |
DrugBank | |
Chemical data | |
Formula | C18H18O2 |
Mol. mass | 266.33 |
SMILES | & |
Synonyms | 3-Hydroxy-1,3,5(10),6,8-estrapentaen-17-one |
Pharmacokinetic data | |
Bioavailability | ? |
Metabolism | ? |
Half life | ? |
Excretion | ? |
Therapeutic considerations | |
Pregnancy cat. |
? |
Legal status | |
Routes | ? |
An estrogenic steroid produced by HORSES. It has a total of five double bonds in the A- and B-ring. High concentration of equilenin is found in the URINE of pregnant mares.
[edit] General Properties
*Molecular Weight
266.33
*Molecular Formula
C18H18O2
*IUPAC NAME
(13S,14S)-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one
*Canonical Smiles
CC12CCC3=C(C1CCC2=O)C=CC4=C3C=CC(=C4)O
*Isomeric Smiles
C[C@]12CCC3=C([C@@H]1CCC2=O)C=CC4=C3C=CC(=C4)O