Androstane-3,17-diol
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
| (One intermediate revision not shown.) | |||
| Line 9: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| + | {{Drugbox | ||
| + | | IUPAC_name = (3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol | ||
| + | | CAS_number = 571-20-0 | ||
| + | | CAS_supplemental = | ||
| + | | PubChem = 441301 | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula =C<sub>18</sub>H<sub>18</sub>O<sub>4</sub> | ||
| + | | molecular_weight = 292.46 | ||
| + | | smiles = C<sub>1</sub><sub>9</sub>H<sub>3</sub><sub>2</sub>O<sub>2</sub> | ||
| + | | synonyms = Androstanediol | ||
| + | | density = | ||
| + | | melting_point = | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
| + | [http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1170&show=SHOW-3D Show 3-D Structure] | ||
==Description== | ==Description== | ||
| - | + | The unspecified form of the steroid, normally a major metabolite of TESTOSTERONE with androgenic activity. It has been implicated as a regulator of gonadotropin secretion.It is produced by 17Beta Hydroxysteroid dehydrogenase. | |
| - | + | ||
| - | The unspecified form of the steroid, normally a major metabolite of | + | |
==General Properties== | ==General Properties== | ||
| Line 34: | Line 58: | ||
C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4O)C)O | C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4O)C)O | ||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| Line 56: | Line 66: | ||
| - | [[ | + | [[Category:Hormones]] |
Current revision
|
|
| Androstane-3,17-diol
| |
| Systematic (IUPAC) name | |
| (3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol | |
| Identifiers | |
| CAS number | |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C18H18O4 |
| Mol. mass | 292.46 |
| SMILES | & |
| Synonyms | Androstanediol |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
[edit] Description
The unspecified form of the steroid, normally a major metabolite of TESTOSTERONE with androgenic activity. It has been implicated as a regulator of gonadotropin secretion.It is produced by 17Beta Hydroxysteroid dehydrogenase.
[edit] General Properties
*Molecular Weight
292.46
*Molecular Formula
C19H32O2
*IUPAC NAME
(3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol
*Canonical Smiles
CC12CCC(CC1CCC3C2CCC4(C3CCC4O)C)O
*Isomeric Smiles
C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4O)C)O
