Etiocholanolone

From DrugPedia: A Wikipedia for Drug discovery

Revision as of 00:00, 15 January 2001 (edit) Special:Contributions/ (Talk) m ← Previous diff		Current revision (04:06, 25 February 2009) (edit) (undo) Deepak (Talk | contribs)
(2 intermediate revisions not shown.)
Line 1:		Line 1:
		+	[http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1066&show=SHOW-3D Show 3-D Structure]
		+	{{drugbox
		+	| IUPAC_name =(3R,5R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one
		+	| synonyms = Aetiocholanolone<br>5-Isoandrosterone
		+	| CAS_number = 53-42-9
		+	| ATC_suffix =
		+	| ATC_supplemental =
		+	| PubChem = 5880
		+	| DrugBank = EXPT00443
		+	|chemical_formula=C19H30O2
		+	| molecular_weight = 290.445 g/mol
		+	| bioavailability =
		+	| protein_bound =
		+	| metabolism =
		+	| elimination_half-life =
		+	| excretion =
		+	| pregnancy_category =
		+	| legal_status =
		+	| routes_of_administration =
		+	}}
		+	'''Etiocholanolone''' (or '''aetiocholanolone''') is a metabolite of [[testosterone]]. Classified a [[ketosteroid]], it causes [[fever]], [[immunostimulation]] and [[leukocytosis]]; is used to evaluate [[adrenal cortex]] function, bone marrow performance and in [[neoplastic]] disease for immunostimulation. Synonym: 5-isoandrosterone.It is excreted in the URINE.
-		+	[[Category:Steroids]]
-	<table align='right' border=1>	+	[[Category:Hormones]]
-	<tr><td>	+
-	<jmol><jmolApplet>	+
-	<size>200</size>	+
-	<script>spin on;color atoms amino;</script>	+
-	<uploadedFileContents>NPH166.SDF</uploadedFileContents>	+
-	<color>black</color>	+
-	</jmolApplet>	+
-	</jmol>	+
-	</td></tr></table>	+
-	==Description==	+
-	The 5-beta-reduced isomer of ANDROSTERONE. Etiocholanolone is a major  metabolite of TESTOSTERONE and ANDROSTENEDIONE in many mammalian  species including humans. It is excreted in the URINE.	+
-	==General Properties==	+
-		+
-	<b>*Molecular Weight</b>	+
-		+
-	290.44	+
-		+
-	<b>*Molecular Formula</b>	+
-		+
-	C<sub>1</sub><sub>9</sub>H<sub>3</sub><sub>0</sub>O<sub>2</sub>	+
-		+
-	<b>*IUPAC NAME</b>	+
-		+
-	(3R,5R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one	+
-		+
-	<b>*Canonical Smiles</b>	+
-		+
-	CC12CCC(CC1CCC3C2CCC4(C3CCC4=O)C)O	+
-		+
-	<b>*Isomeric Smiles</b>	+
-		+
-	C[C@]12CC[C@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)O	+
-		+
-		+
-	==PhysioChemical Properties==	+
-		+
-	<b>*Melting Point</b>	+
-		+
-		+
-		+
-	<b>*LogP</b>	+
-		+
-		+
-		+
-	<b>*Water Solubility</b>	+
-		+
-		+
-		+
-	==External Links==	+
-	*[http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5880]Pubchem	+
-	*[http://www.rcsb.org/pdb/cgi/explore.cgi?pdbId=1DBJ]]1DBJ,	+
-	*[http://www.genome.jp/dbget-bin/www_bget?compound+C04373]KEGG Compound	+
-	*[http://www.hmdb.ca/metabolites/HMDB00490]Human Metabolome DataBase	+
-	*[http://www.drugbank.ca/drugs/DB02854]Drugbank	+
-		+
-	[[Categories:Hormones]]	+

---

Current revision

Show 3-D Structure

Etiocholanolone
Systematic (IUPAC) name
(3R,5R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one
Identifiers
CAS number	53-42-9
ATC code	?
PubChem	5880
DrugBank	EXPT00443
Chemical data
Formula	C19H30O2
Mol. mass	290.445 g/mol
Synonyms	Aetiocholanolone 5-Isoandrosterone
Pharmacokinetic data
Bioavailability	?
Metabolism	?
Half life	?
Excretion	?
Therapeutic considerations
Pregnancy cat.	?
Legal status
Routes	?

Etiocholanolone (or aetiocholanolone) is a metabolite of testosterone. Classified a ketosteroid, it causes fever, immunostimulation and leukocytosis; is used to evaluate adrenal cortex function, bone marrow performance and in neoplastic disease for immunostimulation. Synonym: 5-isoandrosterone.It is excreted in the URINE.