Epimestrol
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m |
|||
| (2 intermediate revisions not shown.) | |||
| Line 1: | Line 1: | ||
| - | |||
| - | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
| Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| - | == | + | |
| + | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1056&show=SHOW-3D Show 3-D Structure] | ||
| + | {{Drugbox | ||
| + | | IUPAC_name = (8R,9S,13S,14S,16R,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol | ||
| + | | CAS_number = | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 244809 | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula =C<sub>1</sub><sub>9</sub>H<sub>2</sub><sub>6</sub>O<sub>3</sub> | ||
| + | | molecular_weight = 302.41 | ||
| + | | smiles = CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)OC | ||
| + | | synonyms = 3-Methoxy-17-epiestriol | ||
| + | | density = | ||
| + | | melting_point = | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
A synthetic steroid with estrogenic activity. | A synthetic steroid with estrogenic activity. | ||
==General Properties== | ==General Properties== | ||
| Line 34: | Line 60: | ||
C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@H]2O)O)CCC4=C3C=CC(=C4)OC | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@H]2O)O)CCC4=C3C=CC(=C4)OC | ||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| Line 56: | Line 68: | ||
| - | [[ | + | [[Category:Hormones]] |
Current revision
|
|
| Epimestrol
| |
| Systematic (IUPAC) name | |
| (8R,9S,13S,14S,16R,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C19H26O3 |
| Mol. mass | 302.41 |
| SMILES | & |
| Synonyms | 3-Methoxy-17-epiestriol |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
A synthetic steroid with estrogenic activity.
[edit] General Properties
*Molecular Weight
302.41
*Molecular Formula
C19H26O3
*IUPAC NAME
(8R,9S,13S,14S,16R,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol
*Canonical Smiles
CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)OC
*Isomeric Smiles
C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@H]2O)O)CCC4=C3C=CC(=C4)OC
