Biochanin A
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m |
|||
(2 intermediate revisions not shown.) | |||
Line 1: | Line 1: | ||
- | |||
- | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
+ | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1024&show=SHOW-3D Show 3-D Structure] | ||
+ | {{Drugbox | ||
+ | | IUPAC_name =5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one | ||
+ | | CAS_number = | ||
+ | | CAS_supplemental = | ||
+ | | ATC_suffix = | ||
+ | | ATC_supplemental = | ||
+ | | PubChem = 5280373 | ||
+ | | ChemSpiderID = | ||
+ | | chemical_formula =C<sub>1</sub><sub>6</sub>H<sub>1</sub><sub>2</sub>O<sub>5</sub> | ||
+ | | molecular_weight = 284.26 | ||
+ | | smiles = COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O | ||
+ | | synonyms = 5,7-Dihydroxy-4'-methoxyisoflavone | ||
+ | | density = | ||
+ | | melting_point = | ||
+ | | boiling_point = | ||
+ | | solubility = | ||
+ | | specific_rotation = | ||
+ | | sec_combustion = | ||
+ | | bioavailability = | ||
+ | | protein_bound = | ||
+ | | metabolism = | ||
+ | | elimination_half-life = | ||
+ | | excretion = | ||
+ | | pregnancy_category= | ||
+ | | dependency_liability = | ||
+ | | routes_of_administration = | ||
+ | }} | ||
==Description== | ==Description== | ||
+ | |||
phytoestrogen; RN given refers to unlabeled cpd; structure | phytoestrogen; RN given refers to unlabeled cpd; structure | ||
==General Properties== | ==General Properties== | ||
Line 32: | Line 59: | ||
<b>*Isomeric Smiles</b> | <b>*Isomeric Smiles</b> | ||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
Line 56: | Line 67: | ||
- | [[ | + | [[Category:Hormones]] |
Current revision
|
Biochanin A
| |
Systematic (IUPAC) name | |
5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one | |
Identifiers | |
CAS number | ? |
ATC code | ? |
PubChem | |
Chemical data | |
Formula | C16H12O5 |
Mol. mass | 284.26 |
SMILES | & |
Synonyms | 5,7-Dihydroxy-4'-methoxyisoflavone |
Pharmacokinetic data | |
Bioavailability | ? |
Metabolism | ? |
Half life | ? |
Excretion | ? |
Therapeutic considerations | |
Pregnancy cat. |
? |
Legal status | |
Routes | ? |
[edit] Description
phytoestrogen; RN given refers to unlabeled cpd; structure
[edit] General Properties
*Molecular Weight
284.26
*Molecular Formula
C16H12O5
*IUPAC NAME
5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one
*Canonical Smiles
COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O
*Isomeric Smiles