|
|
(8 intermediate revisions not shown.) |
Line 1: |
Line 1: |
- | '''Estriol''' | + | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1062&show=SHOW-3D Show 3-D Structure] |
- | Pubchem(5756)
| + | {{Drugbox |
| + | | IUPAC_name = (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
| + | | CAS_number = 50-27-1 |
| + | | CAS_supplemental = |
| + | | ATC_suffix = |
| + | | ATC_supplemental = |
| + | | PubChem = 5756 |
| + | | ChemSpiderID = |
| + | | chemical_formula =C<sub>18</sub>H<sub>24</sub>O<sub>3</sub> |
| + | | molecular_weight = 298.33 |
| + | | smiles = CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O |
| + | | synonyms = Oestriol |
| + | | density = |
| + | | melting_point = 282 |
| + | | boiling_point = |
| + | | solubility = 441 mg/L 25<sup>o</sup>C EST |
| + | | specific_rotation = |
| + | | sec_combustion = |
| + | | bioavailability = |
| + | | protein_bound = |
| + | | metabolism = |
| + | | elimination_half-life = |
| + | | excretion = |
| + | | pregnancy_category= |
| + | | dependency_liability = |
| + | | routes_of_administration = |
| + | }} |
| + | '''Estriol'''(also '''oestriol''') is one of the three main [[estrogen]]s produced by the human body. It is only produced in significant amounts during [[pregnancy]] as it is made by the [[placenta]]. In pregnant women with [[multiple sclerosis]] (MS), estriol reduces the disease's symptoms noticeably, according to researchers at UCLA's Geffen Medical School. |
| | | |
| A hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3-beta, 16-alpha, and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY, large amount of estriol is produced by the PLACENTA. Isomers with inversion of the hydroxyl group or groups are called epiestriol. | | A hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3-beta, 16-alpha, and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY, large amount of estriol is produced by the PLACENTA. Isomers with inversion of the hydroxyl group or groups are called epiestriol. |
| | | |
- | '''Drug Type''': Small Molecule; Approved
| + | ==Physiochemical Properties == |
- | '''Pharmacology''': Estriol (also oestriol) is one of the three main estrogens produced by the human body. It is only produced in significant amounts during pregnancy as it is made by the placenta. In pregnant women with multiple sclerosis (MS), estriol reduces the disease's symptoms noticeably, according to researchers at UCLA's Geffen Medical School.
| + | ===Melting Point=== |
- | | + | 282 deg C EXP |
- | '''Mechanism of Action''': Estriol levels can be measured to give an indication of the general health of the fetus. DHEA-S is produced by the adrenal cortex of the fetus. This is converted to estriol by the placenta. If levels of 'unconjugated estriol' are abnormally low in a pregnant woman, this may indicate a problem with the development of the child.
| + | ===log P=== |
- | | + | 2.45 EXP |
- | '''Indication''': Used as a test to determine the general health of an unborn fetus.
| + | ===Water Solubility=== |
- | | + | 441 mg/L 25<sup>o</sup>C EST |
- | '''KEGG Pathway'''(C05141,D00185) | + | ===Vapor Pressure=== |
- | *Androgen and estrogen metabolism
| + | 1.97E-10 mm Hg 25<sup>o</sup>C EST |
- | '''Target''' estrogen receptor (ER) agonist
| + | ===Henry's Law Constant=== |
- | '''Activity''' Estrogen
| + | 1.33E-12 atm-m3/mole 25 EST |
| + | ===Atmospheric OH Rate Constant=== |
| + | 1.29E-10 cm3/molecule-sec 25 EST |
| + | ==Toxicity== |
| {| border="1;width:100%; height:200px;style=text-align:center" | | {| border="1;width:100%; height:200px;style=text-align:center" |
- | |+'''List of PDB files having estradiol as a Ligand:''' | + | |+'''Toxicity:''' |
| |- | | |- |
- | ! style="background:brown; color:white" |MMDB ID | + | ! style="background:white; color:blue" |Organism |
- | ! style="background:brown; color:white" |PDB ID | + | ! style="background:white; color:blue" |Test Type |
- | ! style="background:brown; color:white" |Reference | + | ! style="background:white; color:blue" |Route |
| + | ! style="background:white; color:blue" |Reported Dose (Normalized Dose) |
| + | ! style="background:white; color:blue" |Effect |
| + | ! style="background:white; color:blue" |Source |
| |- | | |- |
- | |30668 | + | |rat |
- | |1X8V | + | |LD50 |
- | |Podust LM, Yermalitskaya LV, Lepesheva GI, Podust VN, Dalmasso EA, Waterman MREstriol bound and ligand-free structures of sterol 14alpha-demethylaseStructure v12, p.1937-1945 | + | |oral |
| + | |> 2gm/kg (2000mg/kg) |
| + | | |
| + | |Drugs in Japan Vol. -, Pg. 176, 1990. |
| |- | | |- |
| |} | | |} |
- | Generally refers to the 17-beta-isomer of estradiol, an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans, it is produced primarily by the cyclic ovaries and the PLACENTA. It is also produced by the adipose tissue of men and postmenopausal women. The 17-alpha-isomer of estradiol binds weakly to estrogen receptors (RECEPTORS, ESTROGEN) and exhibits little estrogenic activity in estrogen-responsive tissues. Various isomers can be synthesized.
| + | |
| | | |
- | ==Production==
| + | Levels of estriol in non-pregnant women do not change much after [[menopause]], and levels are not significantly different from levels in men. |
- | During the reproductive years, most estradiol in women is produced by the granulosa cells of the ovary|ovaries by the aromatization of androstenedione (produced in the theca folliculi cells} to estrone, followed by conversion of estrone to estradiol by 17β-hydroxysteroid reductase. Smaller amounts of estradiol are also produced by the adrenal cortex, and in me), by the testes.
| + | |
- | Estradiol is not only produced in the gonads: in both sexes, precursor hormones, specifically testosterone, are converted by [[aromaticity|aromatization]] to estradiol. In particular, [[adipose tissue|fat cells]] are active to convert precursors to estradiol, and will continue to do so even after menopause. Estradiol is also produced in the brain and in [[artery|arterial wall]]s.
| + | |
| | | |
- | ==Mechanism of action== | + | ==Use in screening== |
- | Estradiol enters cells freely and interacts with a cytoplasmic target [[cell receptor]]. When the [[estrogen receptor]] has bound its [[ligand]] it can enter the [[cell nucleus|nucleus]] of the target cell, and regulate [[gene transcription]] which leads to formation of [[messenger RNA]]. The mRNA interacts with [[ribosome]]s to produce specific proteins that express the effect of estradiol upon the target cell.
| + | Estriol levels can be measured to give an indication of the general health of the fetus. [[DHEA-S]] is produced by the [[adrenal cortex]] of the fetus. This is converted to estriol by the [[placenta]]. |
| | | |
- | Estradiol binds well to both estrogen receptors, ERα and ERβ, in contrast to certain other estrogens, notably medications that preferentially act on one of these receptors. These medications are called [[selective estrogen receptor modulator]]s, or SERMs.
| + | If levels of "unconjugated estriol" are abnormally low in a pregnant woman, this may indicate a chrmosomal or congenital anomalies like [[Down's syndrome]] or [[Edward's syndrome]]. It is included as part of the [[triple test]] & [[quadrupole test]] for antenatal screening for fetal anomalies. |
| | | |
- | '''Half Life:''' 36 hours | + | Because many pathological conditions in a pregnant woman can cause deviations in estriol levels, these screenings are often seen as less definitive of fetal-placental health than [[non-stress testing]]. Conditions which can create [[false-positives]] and [[false-negatives]] in estriol testing for fetal distress include [[preeclampsia]], [[anemia]] and impaired [[kidney function]].<ref>{{cite book |title=Mosby's manual of Diagnostic and Laboratory Tests, 2nd Edition |first=Kathleen |last=Deska Pagana |coauthors=Pagana, Timothy J. |year=2002}}</ref> |
- | '''Drug Type:''' Small Molecule; Approved; Investigational
| + | |
| | | |
- | '''Pharmacology:''' Estradiol, the principal intracellular human estrogen, is substantially more active than its metabolites, estrone and estriol, at the cellular level.
| + | ==References== |
- | '''Indication:''' For the treatment of urogenital symptoms associated with post-menopausal atrophy of the vagina (such as dryness, burning, pruritus and dyspareunia) and/or the lower urinary tract (urinary urgency and dysuria).
| + | <references/> |
| | | |
- | Estradiol is the most potent naturally-occurring estrogen.
| + | {{med-stub}} |
| + | {{Sex hormones}} |
| | | |
- | Recently there has been speculation about a membrane estrogen receptor, ERX.
| + | [[Category:Hormones]] |
- | ==Metabolism==
| + | [[Category:Estrogens]] |
- | In plasma, estradiol is largely bound to [[sex hormone binding globulin]], also to [[albumin]], -only a fraction is free and biologically active. Deactivation includes conversion to less active estrogens such as [[estrone]] and [[estriol]]. Estriol is the major urinary metabolite. Estradiol is conjugated in the liver by sulfate and glucuronide formation and as such excreted via the kidneys. Some of the watersoluble conjugates are excreted via the bile duct, and partly reabsorbed after [[hydrolysis]] from the intestinal tract. This [[enterohepatic circulation]] contributes to maintaining estradiol levels.
| + | |
- | | + | |
- | ==Measurement==
| + | |
- | Serum estradiol measurement in women reflects primarily the activity of the ovaries. As such they are useful in the detection of baseline estrogen in women with [[amenorrhea]] or menstrual dysfunction and to detect the state of hypoestrogenicity and [[menopause]]. Furthermore, estrogen monitoring during fertility therapy assesses follicular growth and is useful in monitoring the treatment. Estrogen-producing tumors will demonstrate persistent high levels of estradiol and other estrogens. In [[precocious puberty]] estradiol levels are inappropriately increased.
| + | |
- | | + | |
- | In the normal [[menstrual cycle]] estradiol levels measure typically <50 ng/ml at menstruation, rise with follicular development, drop briefly at ovulation, and rise again during the luteal phase for a second peak. At the end of the luteal phase estradiol levels drop to their menstrual levels unless there is a pregnancy.
| + | |
- | | + | |
- | During [[pregnancy]] estrogen levels including estradiol rise steadily towards term. The source of these estrogens is the [[placenta]] that aromatizes prohormones produced in the fetal adrenal gland.
| + | |
- | | + | |
- | ==Effects==
| + | |
- | ===Female reproduction===
| + | |
- | In the female, estradiol acts as a growth hormone for tissue of the reproductive organs, supporting the lining of the [[vagina]], the cervical glands, the [[endometrium]] and the lining of the fallopian tubes. It enhances growth of the [[myometrium]]. Estradiol appears necessary to maintain [[oocyte]]s in the [[ovary]]. During the [[menstrual cycle]], estradiol that is produced by the growing follicle triggers, via a positive feedback system, the hypothalamic-pituitary events that lead to the [[luteinizing hormone]] surge, inducing ovulation. In the luteal phase estradiol, in conjunction with [[progesterone]], prepares the endometrium for [[implantation]]. During [[pregnancy]] estradiol increases due to [[placenta]]l production. In baboons, blocking of estrogen production leads to pregnancy loss suggesting that estradiol has a role in the maintenance of pregnancy. Research is investigating the role of estrogens in the process of initiation of [[Childbirth|labor]].
| + | |
- | | + | |
- | ===Sexual development===
| + | |
- | The development of [[secondary sex characteristics]] in women is driven by estrogens, specifically estradiol. These changes are initiated at the time of puberty, most enhanced during the reproductive years, and become less pronounced with declining estradiol support after the menopause. Thus, estradiol enhances breast development, and is responsible for changes in the body shape affecting bones, joints, fat deposition. Fat structure and skin composition are modified by estradiol.
| + | |
- | | + | |
- | ===Male reproduction===
| + | |
- | The effect of estradiol (and estrogens) upon male reproduction is complex. Estradiol is produced in the [[Sertoli cell]]s of the testes. There is evidence that estradiol is to prevent [[apoptosis]] of male germ cells. <ref>Pentikäinen V, Erkkilä K, Suomalainen L, Parvinen M, Dunkel L. Estradiol Acts as a Germ Cell Survival Factor in the Human Testis ''in vitro''.
| + | |
- | The Journal of Clinical Endocrinology & Metabolism 2006;85:2057-67 PMID 10843196</ref>
| + | |
- | | + | |
- | Several studies have noted that [[sperm count]]s have been declining in many parts of the world and it has been postulated that this may be related to estrogen exposure in the environment.<ref> Sharpe RM, Skakkebaek NE. Are oestrogens involved in falling sperm counts and disorders of the male reproductive tract? Lancet. 1993 May 29;341(8857):1392-5. PMID 8098802 </ref> Suppression of estradiol production in a subpopulation of subfertile men may improve the semen analysis.<ref>Raman JD, Schlegel PN. Aromatase Inhibitors for Male Infertility. Journal of Urology. (2002), 167: 624-629. PMID 11792932</ref>
| + | |
- | | + | |
- | Males with sex chromosome genetic conditions such as [[Klinefelters Syndrome]] will have a higher level of estradiol.
| + | |
- | | + | |
- | ===Bone===
| + | |
- | There is ample evidence that estradiol has a profound effect on bone. Individuals without estradiol (or other estrogens) will become tall and eunuchoid as epiphysieal closure is delayed or may not take place. Bone structure is affected resulting in early osteopenia and osteoporosis. <ref>Carani C, Qin K, Simoni M, Faustini-Fustini M, Serpente S, Boyd J, Korach KS, Simpson ER. Effect of Testosterone and Estradiol in a Man with Aromatase Deficiency. New England Journal of Medicine Volume 337:91-95 July 10, 1997 PMID 9211678</ref> Also, women past menopause experience an accelerated loss of bone mass due to a relative estrogen deficiency.
| + | |
- | | + | |
- | ===Liver===
| + | |
- | Estradiol has complex effects on the liver. It can lead to [[cholestasis]]. It affects the production of multiple proteins including [[lipoprotein]]s, binding proteins, and proteins responsible for [[blood clotting]].
| + | |
- | | + | |
- | ===Brain===
| + | |
- | Estrogens can be produced in the brain from steroid precursors. As [[antioxidants]], they have been found to have neuroprotective function.<ref>Behl C, Widmann M, Trapp T, Holsboer F. 17-beta estradiol protects neurons from oxidative stress-induced cell death ''in vitro''. Biochem Biophys Res Commun. 1995 Nov 13;216(2):473-82. PMID 7488136 </ref> | + | |
- | The positive and negative [[feedback loop]] of the [[menstrual cycle]] involve ovarian estradiol as the link to the hypothalamic-pituitary system to regulate [[gonadotropin]]s.
| + | |
- | | + | |
- | Estrogen is considered to play a significant role in women’s mental health. A conceptual model of how estrogen affects mood was suggested by Douma et al 2005 based on their extensive literature review relating activity of endogenous, bio-identical and synthetic estrogen with mood and well-being. They concluded that the sudden estrogen withdrawal, fluctuating estrogen, and periods of sustained estrogen low levels correlated with significant mood lowering. Clinical recovery from depression postpartum, perimenopause, and postmenopause was shown to be effective after levels of estrogen were stabilized and/or restored.<ref>Douma SL, Husband C., O’Donnell, M.E., Barwin B.N., Woodend AK. Estrogen-related Mood Disorders Reproductive Life Cycle Factors.Advances in Nursing Science(2005), 28: No. 4:147-160.</ref>
| + | |
- | <ref>Lasiuk GC,.The Effects of Estradiol on Central Serotonergic Systems and Its Relationship to Mood in Women. Biological Research for Nursing. (2007), 9: No. 2:364-375. DOI: 10.1177/1099500407605600</ref>
| + | |
- | | + | |
- | ===Blood vessels===
| + | |
- | Estrogen affects certain blood vessels. Improvement in arterial blood flow has been demonstrated in [[coronary artery|coronary arteries]].<ref>Collins P, Rosano GM, Sarrel PM, Ulrich L, Adamopoulos S, Beale CM, McNeill JG, Poole-Wilson PA. 17 beta-Estradiol attenuates acetylcholine-induced coronary arterial constriction in women but not men with coronary heart disease. Circulation. 1995 Jul 1;92(1):24-30 PMID 7788912 </ref>
| + | |
- | | + | |
- | ===Oncogene===
| + | |
- | Estrogen is suspected to activate certain [[oncogenes]], as it supports certain cancers, notably [[breast cancer]] and cancer of the [[uterine lining]]. In addition there are several benign gynecologic conditions that are dependent on estrogen such as [[endometriosis]], [[leiomyoma]]ta uteri, and uterine bleeding.
| + | |
- | | + | |
- | ===Pregnancy===
| + | |
- | The effect of estradiol, together with [[estrone]] and [[estriol]], in [[pregnancy]] is less clear. They may promote uterine blood flow, myometrial growth, sitmulate breast growth and at term, promote cervical softening and expression of myometrial [[oxytocin]] receptors.
| + | |
- | | + | |
- | ==Role in [[sex differentiation]] of the brain==
| + | |
- | One of the fascinating twists to mammalian sex differentiation is that estradiol is one of the two active metabolites of testosterone in males (the other being [[dihydrotestosterone]]), and since fetuses of both sexes are exposed to similarly high levels of maternal estradiol, this source cannot have a significant impact on prenatal sex differentiation. Estradiol cannot be transferred readily from the circulation into the brain, while testosterone can, thus sex differentiation can be caused by the testosterone in the brain of most male mammals, including humans, aromatizing in significant amounts into estradiol. There is also now evidence that the programming of adult male sexual behavior in animals is largely dependent on estradiol produced in the central nervous system during prenatal life and early infancy from testosterone. <ref>{{cite journal | last = Harding | first = Prof. Cheryl F. | title = Hormonal Modulation of Singing: Hormonal Modulation of the Songbird Brain and Singing Behavior | journal = Ann. N.Y. Acad. Sci. | volume = 1016 | pages = 524–539 | publisher = The New York Academy of Sciences | month = June | year = 2004 | url = http://www.annalsnyas.org/content/vol1016/issue1/index.dtl | doi = 10.1196/annals.1298.030 | accessdate = 2007-03-07}}</ref> However, it is not yet known whether this process plays a minimal or significant part in human sexual behaviors although evidence from other mammals tends to indicate that it does. <ref>{{cite journal | last = Simerly | first = Richard B. | title = Wired for reproduction: organization and development of sexually dimorphic circuits in the mammalian forebrain | journal = Annual Rev. Neurosci. | volume = 25 | pages =507–536 | date = 2002-03-27 | url = http://www.healthsystem.virginia.edu/internet/neuroscience/BehavioralNeuroscience/Simerley-EFR-1-4.pdf | doi = 10.1146/annurev.neuro.25.112701.142745 | pmid = 12052919 | format = pdf | accessdate = 2007-03-07}}</ref>
| + | |
- | | + | |
- | Recently, it was discovered that volumes of [[Sexual dimorphism|sexually dimorphic]] brain structures in phenotypical males changed to approximate those of typical female brain structures when exposed to estradiol over a period of months. <ref name="eje-utrecht">{{cite journal| author = Hulshoff, Cohen-Kettenis et al. | year = 2006 | month = July | title = Changing your sex changes your brain: influences of testosterone and estrogen on adult human brain structure | url = http://www.eje-online.org/cgi/content/abstract/155/suppl_1/S107 | journal = European Journal of Endocrinology | issue = 155 | pages = 107–114 | doi = 10.1530/eje.1.02248 | id = {{ISSN|0804-4643}} | | volume = 155}}</ref> This would suggest that estradiol has a significant part to play in sex differentiation of the brain, both pre-natal and throughout life.
| + | |
- | | + | |
- | ==Estradiol medication==
| + | |
- | Estrogen is marketed in a number of ways to address issues of [[hypoestrogenism]]. Thus there are oral, transdermal, topical, injectable, and vaginal preparations. Furthermore, the estradiol molecule may be linked to an [[alkyl]] group at C3 position to facilitate the administration. Such modifications give rise to '''estradiol acetate''' (oral and vaginal applications) and to '''estradiol cyprionate''' (injectable).
| + | |
- | | + | |
- | Oral preparations are not necessarily predictably absorbed and subject to a first pass through the liver where they can be metabolized and also initiate unwanted side effects. Thus, alternative routes of administration have been developed that bypass the liver before primary target organs are hit. Transdermal and transvaginal routes are not subject to the initial liver passage.
| + | |
- | | + | |
- | A more profound alteration is [[ethinylestradiol]], the most common estrogen ingredient in [[combined oral contraceptive pill]]s
| + | |
- | | + | |
- | ==Therapy==
| + | |
- | ===Hormone replacement therapy===
| + | |
- | If severe side effects of low levels of estradiol in a woman's blood are experienced (commonly at the beginning of [[menopause]] or after [[oophorectomy]]), [[hormone replacement therapy]] may be prescribed. Often such therapy is combined with a [[progestin]].
| + | |
- | | + | |
- | Estrogen therapy may be used in treatment of [[infertility]] in women when there is a need to develop sperm-friendly [[cervix|cervical]] mucus or an appropriate uterine lining.
| + | |
- | | + | |
- | Estrogen therapy is also used to maintain female hormone levels in [[male-to-female transsexual]]s.
| + | |
- | ===Estrogen and Mood===
| + | |
- | Estrogen is considered to play a significant role in women’s mental health. A conceptual model of how estrogen affects mood was suggested by Douma et al 2005 based on their extensive literature review relating activity of endogenous, bio-identical and synthetic estrogen with mood and well-being. They concluded the sudden estrogen withdrawal, fluctuating estrogen, and periods of sustained estrogen low levels correlated with significant mood lowering. Clinical recovery from depression postpartum, perimenopause, and postmenopause was shown to be affective after levels of estrogen were stabilized and/or restored.
| + | |
- | | + | |
- | ===Blocking estrogens===
| + | |
- | Inducing a state of hypoestrogenism may be beneficial in certain situations where estrogens are contributing to unwanted effects, e.g, certain forms of [[breast cancer]], [[gynecomastia]], and premature [[bone maturation|closure of epiphyses]]. Estrogen levels can be reduced by inhibiting production using gonadotropin- releasing factor agonists ([[GnRH agonist]]s) or blocking the aromatase enzyme using an [[aromatase inhibitor]], or estrogen effects can be reduced with estrogen antagonists such as [[tamoxifen]]. Flaxseed is known to reduce estradiol.<ref>{{cite book | first=Andrew | last= Chevallier | year= 2000 | title=Encyclopedia of Herbal Medicine: The Definitive Home Reference Guide to 550 Key Herbs with all their Uses as Remedies for Common Ailments | chapter= | editor=Gillian Emerson-Roberts | others= | pages= | publisher= DK Publishing | isbn=0-7894-6783-6 | url= | authorlink= }}</ref>
| + | |
- | | + | |
- | ===Hormonal contraception===
| + | |
- | A synthetic form of estradiol, called [[ethinylestradiol]] is a major component of hormonal contraceptive devices. Combined forms of [[hormonal contraception]] contain [[ethinylestradiol]] and a [[progestin]], which both contribute to the inhibition of [[GnRH]], [[Luteinizing hormone|LH]], and [[FSH]]. The inhibition of these [[hormones]] accounts for the ability of these [[birth control]] methods to prevent ovulation and thus prevent pregnancy. Other types of hormonal birth control contain only [[progestins]] and no [[ethinylestradiol]].
| + | |
- | | + | |
- | ===List of estradiol medications===
| + | |
- | The following are marketed versions of estradiol:
| + | |
- | * Oral versions: Estrace, Activella (also contains a progestin), estradiol acetate, Progynova, estrofem
| + | |
- | * Transdermal preparation: Alora, Climara, Vivelle, Vivelle-Dot, Menostar, Estraderm TTS
| + | |
- | * Ointments: Estrasorb Topical, Estrogel, Elestrin
| + | |
- | * Injection: Estradiol cypionate: Lunelle monthly injection, Estradiol valerate
| + | |
- | * Vaginal ointment: Estrace Vaginal Cream, Premarin Cream
| + | |
- | * Vaginal ring: Estring (estradiol acetate), Femring
| + | |
- | | + | |
- | Estradiol is also part of conjugated estrogen preparations, including [[Premarin]] but is not the major ingredient (Premarin consists of hundreds of estrogen derivatives due to its natural source...'''pre'''gnant '''mar'''e ur'''in'''e.
| + | |
- | | + | |
- | ==Contraindications==
| + | |
- | Estradiol should not be given to women who are pregnant or are breastfeeding, women with unexplained uterine bleeding, certain forms of cancer, or prone to blood clotting disorders. The medication is to be kept away from children. Detailed prescription information is available <ref>[http://warnerchilcott.com/pdfs/pi/pi_estrace_wc_imprint.pdf Estrace/Estradiol patient information leaflet] - Warner Chilcott (manufacturer)</ref>
| + | |
- | | + | |
- | ==Side effects==
| + | |
- | Side effects of estradiol therapy may include uterine bleeding, breast tenderness, nausea and vomiting, [[chloasma]], cholestasis, and [[migraine]] headaches.
| + | |
- | | + | |
- | Therapeutic Indications
| + | |
- | * Menopause
| + | |
- | * Osteoporosis
| + | |
- | | + | |
- | KEGG Database(C00951,D00105)
| + | |
- | Pathway
| + | |
- | Androgen and estrogen metabolism
| + | |
- | Prostate cancer
| + | |
- | | + | |
- | {| border="1;width:100%; height:200px;style=text-align:center"
| + | |
- | |+'''List of PDB files having estradiol as a Ligand:'''
| + | |
- | |-
| + | |
- | ! style="background:brown; color:white" |MMDB ID
| + | |
- | ! style="background:brown; color:white" |PDB ID
| + | |
- | ! style="background:brown; color:white" |Reference
| + | |
- | |-
| + | |
- | |14139
| + | |
- | |1QKT
| + | |
- | |Gangloff M, Ruff M, Eiler S, Duclaud S, Wurtz JM, Moras DCrystal structure of a mutant hERalpha ligand-binding domain reveals key structural features for the mechanism of partial agonismJ. Biol. Chem. v276, p.15059-15065
| + | |
- | |-
| + | |
- | |14140
| + | |
- | |1QKU
| + | |
- | |Gangloff M, Ruff M, Eiler S, Duclaud S, Wurtz JM, Moras DCrystal structure of a mutant hERalpha ligand-binding domain reveals key structural features for the mechanism of partial agonismJ. Biol. Chem. v276, p.15059-15065
| + | |
- | |-
| + | |
- | |17807
| + | |
- | |1JGL
| + | |
- | |Lamminmaki U, Kankare JACrystal structure of a recombinant anti-estradiol Fab fragment in complex with 17beta -estradiolJ. Biol. Chem. v276, p.36687-36694
| + | |
- | |-
| + | |
- | |18390
| + | |
- | |1G50
| + | |
- | |Eiler S, Gangloff M, Duclaud S, Moras D, Ruff MOverexpression, purification, and crystal structure of native ER alpha LBDProtein Expr. Purif. v22, p.165-173
| + | |
- | |-
| + | |
- | |18412
| + | |
- | |1JNN
| + | |
- | |Monnet C, Bettsworth F, Stura EA, Le Du MH, Menez R, Derrien L, Zinn-Justin S, Gilquin B, Sibai G, Battail-Poirot N, Jolivet M, Menez A, Arnaud M, Ducancel F, Charbonnier JBHighly specific anti-estradiol antibodies: structural characterisation and binding diversityJ. Mol. Biol. v315, p.699-712
| + | |
- | |-
| + | |
- | |20338
| + | |
- | |1GWR
| + | |
- | |Warnmark A, Treuter E, Gustafsson JA, Hubbard RE, Brzozowski AM, Pike ACInteraction of transcriptional intermediary factor 2 nuclear receptor box peptides with the coactivator binding site of estrogen receptor alphaJ. Biol. Chem. v277, p.21862-21868
| + | |
- | |-
| + | |
- | |20905
| + | |
- | |1LHU
| + | |
- | |Grishkovskaya I, Avvakumov GV, Hammond GL, Catalano MG, Muller YASteroid ligands bind human sex hormone-binding globulin in specific orientations and produce distinct changes in protein conformationJ. Biol. Chem. v277, p.32086-32093
| + | |
- | |-
| + | |
- | |25056
| + | |
- | |1PCG
| + | |
- | |Leduc AM, Trent JO, Wittliff JL, Bramlett KS, Briggs SL, Chirgadze NY, Wang Y, Burris TP, Spatola AFHelix-stabilized cyclic peptides as selective inhibitors of steroid receptor-coactivator interactionsProc. Natl. Acad. Sci. U. S. A. v100, p.11273-11278
| + | |
- | |-
| + | |
- | |35805
| + | |
- | | 2D06
| + | |
- | |Gamage NU, Tsvetanov S, Duggleby RG, McManus ME, Martin JLThe structure of human SULT1A1 crystallized with estradiol. An insight into active site plasticity and substrate inhibition with multi-ring substratesJ. Biol. Chem. v280, p.41482-41486
| + | |
- | |-
| + | |
- | |43057
| + | |
- | |2J7X
| + | |
- | |Structure Of Estradiol-Bound Estrogen Receptor Beta Lbd In Complex With Lxxll Motif From Ncoa5.
| + | |
- | Pike ACW, Brzozowski AM, Hubbard RE, Walton J, Bonn T, - A, Thorsell G, Engstrom O, Ljunggren J, Gustaffson J-A, Carlquist M, 2006/10/17
| + | |
- | |-
| + | |
- | |47760
| + | |
- | |1A52
| + | |
- | |Tanenbaum DM, Wang Y, Williams SP, Sigler PBCrystallographic comparison of the estrogen and progesterone receptor's ligand binding domainsProc. Natl. Acad. Sci. U. S. A. v95, p.5998-6003
| + | |
- | |-
| + | |
- | |47957
| + | |
- | |1AQU
| + | |
- | |Kakuta Y, Pedersen LG, Carter CW, Negishi M, Pedersen LCCrystal structure of estrogen sulphotransferaseNat. Struct. Biol. v4, p.904-908
| + | |
- | |-
| + | |
- | |49701
| + | |
- | |1IOL
| + | |
- | |Azzi A, Rehse PH, Zhu DW, Campbell RL, Labrie F, Lin SXCrystal structure of human estrogenic 17 beta-hydroxysteroid dehydrogenase complexed with 17 beta-estradiolNat. Struct. Biol. v3, p.665-668
| + | |
- | |-
| + | |
- | |55024
| + | |
- | |1A27
| + | |
- | |Mazza C, Breton R, Housset D, Fontecilla-Camps JCUnusual charge stabilization of NADP+ in 17beta-hydroxysteroid dehydrogenaseJ. Biol. Chem. v273, p.8145-8152
| + | |
- | |-
| + | |
- | |56114
| + | |
- | |1FDS
| + | |
- | |Breton R, Housset D, Mazza C, Fontecilla-Camps JCThe structure of a complex of human 17beta-hydroxysteroid dehydrogenase with estradiol and NADP+ identifies two principal targets for the design of inhibitorsStructure v4, p.905-915
| + | |
- | |-
| + | |
- | |56115
| + | |
- | |1FDT
| + | |
- | |Breton R, Housset D, Mazza C, Fontecilla-Camps JCThe structure of a complex of human 17beta-hydroxysteroid dehydrogenase with estradiol and NADP+ identifies two principal targets for the design of inhibitorsStructure v4, p.905-915
| + | |
- | |-
| + | |
- | |56116
| + | |
- | |1FDW
| + | |
- | |Mazza C, Breton R, Housset D, Fontecilla-Camps JCUnusual charge stabilization of NADP+ in 17beta-hydroxysteroid dehydrogenaseJ. Biol. Chem. v273, p.8145-8152
| + | |
- | |-
| + | |
- | |60515
| + | |
- | |2OCF
| + | |
- | |Rajan SS, Kuruvilla SM, Sharma SK, Kim Y, Huang J, Koide A, Koide S, Joachimiak A, Greene GL, 2006/12/20
| + | |
- | |-
| + | |
- | |8897
| + | |
- | |1ERE
| + | |
- | |Brzozowski AM, Pike AC, Dauter Z, Hubbard RE, Bonn T, Engstrom O, Ohman L, Greene GL, Gustafsson JA, Carlquist MMolecular basis of agonism and antagonism in the oestrogen receptorNature v389, p.753-758
| + | |
- | |-
| + | |
- | |}
| + | |
- | {| border="1;width:100%; height:200px;style=text-align:center"
| + | |
- | |+'''Physiochemical properties of Estradiol:'''
| + | |
- | |-
| + | |
- | ! style="background:brown; color:white" |Physical Property
| + | |
- | ! style="background:brown; color:white" |Value
| + | |
- | ! style="background:brown; color:white" |Units
| + | |
- | ! style="background:brown; color:white" |Temp (deg C)
| + | |
- | ! style="background:brown; color:white" |Source
| + | |
- | |-
| + | |
- | |Melting Point
| + | |
- | |282
| + | |
- | |deg C
| + | |
- | |
| + | |
- | |EXP
| + | |
- | |-
| + | |
- | |log P (octanol-water)
| + | |
- | |2.45
| + | |
- | |(none)
| + | |
- | |
| + | |
- | |EXP
| + | |
- | |-
| + | |
- | |Water Solubility
| + | |
- | |441
| + | |
- | |mg/L
| + | |
- | |25
| + | |
- | |EST
| + | |
- | |-
| + | |
- | |Vapor Pressure
| + | |
- | |1.97E-10
| + | |
- | |mm Hg
| + | |
- | |25
| + | |
- | |EST
| + | |
- | |-
| + | |
- | |Henry's Law Constant
| + | |
- | |1.33E-12
| + | |
- | |atm-m3/mole
| + | |
- | |25
| + | |
- | |EST
| + | |
- | |-
| + | |
- | |Atmospheric OH Rate Constant
| + | |
- | |1.29E-10
| + | |
- | |cm3/molecule-sec
| + | |
- | |25
| + | |
- | |EST
| + | |
- | |-
| + | |
- | |}
| + | |
- | Organism Test Type Route Reported Dose (Normalized Dose) Effect Source
| + | |
- | |rat
| + | |
- | |LD50
| + | |
- | |oral
| + | |
- | |> 2gm/kg (2000mg/kg)
| + | |
- | |Drugs in Japan Vol. -, Pg. 176, 1990.
| + | |
- | |-
| + | |
- | |}
| + | |
A hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3-beta, 16-alpha, and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY, large amount of estriol is produced by the PLACENTA. Isomers with inversion of the hydroxyl group or groups are called epiestriol.
Estriol levels can be measured to give an indication of the general health of the fetus. DHEA-S is produced by the adrenal cortex of the fetus. This is converted to estriol by the placenta.
If levels of "unconjugated estriol" are abnormally low in a pregnant woman, this may indicate a chrmosomal or congenital anomalies like Down's syndrome or Edward's syndrome. It is included as part of the triple test & quadrupole test for antenatal screening for fetal anomalies.