Beta-erythroidine
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m |
(→Description) |
||
| (One intermediate revision not shown.) | |||
| Line 24: | Line 24: | ||
==Description== | ==Description== | ||
| - | alkaloid found in various species of Erythrina; RN given refers to parent cpd; | + | alkaloid found in various species of Erythrina; RN given refers to parent cpd; |
| + | |||
| + | Dihydro analog of beta-erythroidine, which is isolated from the seeds and other plant parts of Erythrina sp. Leguminosae. It is an alkaloid with curarimimetic properties. | ||
==General Properties== | ==General Properties== | ||
Current revision
| Beta-erythroidine
| |
| Systematic (IUPAC) name | |
| N/A | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C16H19NO3 |
| Mol. mass | 273.32696 |
| SMILES | & |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
[edit] Description
alkaloid found in various species of Erythrina; RN given refers to parent cpd;
Dihydro analog of beta-erythroidine, which is isolated from the seeds and other plant parts of Erythrina sp. Leguminosae. It is an alkaloid with curarimimetic properties.
[edit] General Properties
*Molecular Weight
273.32696
*Molecular Formula
C16H19NO3
*IUPAC NAME
N/A
*Canonical Smiles
COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4
*Isomeric Smiles
CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4
*XLogP
-0.2
*Topological Polar Surface Area
38.8
