Biochanin A
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m (1 revision) |
|||
| (One intermediate revision not shown.) | |||
| Line 1: | Line 1: | ||
| - | |||
| - | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
| Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| + | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1024&show=SHOW-3D Show 3-D Structure] | ||
| + | {{Drugbox | ||
| + | | IUPAC_name =5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one | ||
| + | | CAS_number = | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 5280373 | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula =C<sub>1</sub><sub>6</sub>H<sub>1</sub><sub>2</sub>O<sub>5</sub> | ||
| + | | molecular_weight = 284.26 | ||
| + | | smiles = COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O | ||
| + | | synonyms = 5,7-Dihydroxy-4'-methoxyisoflavone | ||
| + | | density = | ||
| + | | melting_point = | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
==Description== | ==Description== | ||
| + | |||
phytoestrogen; RN given refers to unlabeled cpd; structure | phytoestrogen; RN given refers to unlabeled cpd; structure | ||
==General Properties== | ==General Properties== | ||
| Line 32: | Line 59: | ||
<b>*Isomeric Smiles</b> | <b>*Isomeric Smiles</b> | ||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| - | |||
| Line 56: | Line 67: | ||
| - | [[ | + | [[Category:Hormones]] |
Current revision
|
|
| Biochanin A
| |
| Systematic (IUPAC) name | |
| 5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C16H12O5 |
| Mol. mass | 284.26 |
| SMILES | & |
| Synonyms | 5,7-Dihydroxy-4'-methoxyisoflavone |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
[edit] Description
phytoestrogen; RN given refers to unlabeled cpd; structure
[edit] General Properties
*Molecular Weight
284.26
*Molecular Formula
C16H12O5
*IUPAC NAME
5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one
*Canonical Smiles
COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O
*Isomeric Smiles
