Androstane-3,17-diol
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
(2 intermediate revisions not shown.) | |||
Line 9: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
+ | {{Drugbox | ||
+ | | IUPAC_name = (3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol | ||
+ | | CAS_number = 571-20-0 | ||
+ | | CAS_supplemental = | ||
+ | | PubChem = 441301 | ||
+ | | ChemSpiderID = | ||
+ | | chemical_formula =C<sub>18</sub>H<sub>18</sub>O<sub>4</sub> | ||
+ | | molecular_weight = 292.46 | ||
+ | | smiles = C<sub>1</sub><sub>9</sub>H<sub>3</sub><sub>2</sub>O<sub>2</sub> | ||
+ | | synonyms = Androstanediol | ||
+ | | density = | ||
+ | | melting_point = | ||
+ | | boiling_point = | ||
+ | | solubility = | ||
+ | | specific_rotation = | ||
+ | | sec_combustion = | ||
+ | | bioavailability = | ||
+ | | protein_bound = | ||
+ | | metabolism = | ||
+ | | elimination_half-life = | ||
+ | | excretion = | ||
+ | | pregnancy_category= | ||
+ | | dependency_liability = | ||
+ | | routes_of_administration = | ||
+ | }} | ||
+ | [http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1170&show=SHOW-3D Show 3-D Structure] | ||
==Description== | ==Description== | ||
- | + | The unspecified form of the steroid, normally a major metabolite of TESTOSTERONE with androgenic activity. It has been implicated as a regulator of gonadotropin secretion.It is produced by 17Beta Hydroxysteroid dehydrogenase. | |
- | The unspecified form of the steroid, normally a major metabolite of | + | |
==General Properties== | ==General Properties== | ||
Line 33: | Line 58: | ||
C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4O)C)O | C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4O)C)O | ||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
- | |||
Line 55: | Line 66: | ||
- | [[ | + | [[Category:Hormones]] |
Current revision
|
Androstane-3,17-diol
| |
Systematic (IUPAC) name | |
(3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol | |
Identifiers | |
CAS number | |
ATC code | ? |
PubChem | |
Chemical data | |
Formula | C18H18O4 |
Mol. mass | 292.46 |
SMILES | & |
Synonyms | Androstanediol |
Pharmacokinetic data | |
Bioavailability | ? |
Metabolism | ? |
Half life | ? |
Excretion | ? |
Therapeutic considerations | |
Pregnancy cat. |
? |
Legal status | |
Routes | ? |
[edit] Description
The unspecified form of the steroid, normally a major metabolite of TESTOSTERONE with androgenic activity. It has been implicated as a regulator of gonadotropin secretion.It is produced by 17Beta Hydroxysteroid dehydrogenase.
[edit] General Properties
*Molecular Weight
292.46
*Molecular Formula
C19H32O2
*IUPAC NAME
(3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol
*Canonical Smiles
CC12CCC(CC1CCC3C2CCC4(C3CCC4O)C)O
*Isomeric Smiles
C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4O)C)O