2,3-bis(3'-hydroxybenzyl)butyrolactone

From DrugPedia: A Wikipedia for Drug discovery

(Difference between revisions)
Jump to: navigation, search
m
Current revision (09:06, 19 February 2009) (edit) (undo)
 
(4 intermediate revisions not shown.)
Line 1: Line 1:
-
 
+
[http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1001&show=SHOW-3D Show 3-D Structure]
-
 
+
{{Drugbox
-
<table align='right' border=1>
+
| IUPAC_name        = 3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one
-
<tr><td>
+
| CAS_number        =  
-
<jmol><jmolApplet>
+
| CAS_supplemental  =
-
<size>200</size>
+
| ATC_suffix = BA03
-
<script>spin on;color atoms amino;</script>
+
| ATC_supplemental  =
-
<uploadedFileContents>NPH101.SDF</uploadedFileContents>
+
| PubChem          = 123917
-
<color>black</color>
+
| ChemSpiderID      =
-
</jmolApplet>
+
| chemical_formula  =C<sub>18</sub>H<sub>18</sub>O<sub>4</sub>
-
</jmol>
+
| molecular_weight  = 298.33
-
</td></tr></table>
+
| smiles            = C1C(C(C(=O)O1)CC2=CC(=CC=C2)O)CC3=CC(=CC=C3)O
 +
| synonyms          = Enterolactone
 +
| density          =
 +
| melting_point    =
 +
| boiling_point    =
 +
| solubility        =
 +
| specific_rotation =
 +
| sec_combustion    =
 +
| bioavailability  =
 +
| protein_bound    =
 +
| metabolism        =
 +
| elimination_half-life =
 +
| excretion        =
 +
| pregnancy_category=
 +
| dependency_liability =
 +
| routes_of_administration =
 +
}}
==Description==
==Description==
-
lignan isolated from urine of humans and other mammals; RN given   refers to cpd without isomeric designation; structure given in second   source
+
lignan isolated from urine of humans and other mammals; RN given refers to cpd without isomeric designation; structure given in second source
-
==General Properties==
+
-
 
+
-
<b>*Molecular Weight</b>
+
-
 
+
-
298.33
+
-
 
+
-
<b>*Molecular Formula</b>
+
-
 
+
-
C<sub>1</sub><sub>8</sub>H<sub>1</sub><sub>8</sub>O<sub>4</sub>
+
-
 
+
-
<b>*IUPAC NAME</b>
+
-
 
+
-
3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one
+
-
 
+
-
<b>*Canonical Smiles</b>
+
-
 
+
-
C1C(C(C(=O)O1)CC2=CC(=CC=C2)O)CC3=CC(=CC=C3)O
+
-
 
+
-
<b>*Isomeric Smiles</b>
+
-
 
+
-
 
+
-
 
+
-
==PhysioChemical Properties==
+
-
 
+
-
<b>*Melting Point</b>
+
-
 
+
-
 
+
-
 
+
-
<b>*LogP</b>
+
-
 
+
-
 
+
-
 
+
-
<b>*Water Solubility</b>
+
-
 
+
-
 
+
-
 
+
-
==External Links==
+
-
*[http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=123917]Pubchem
+
-
 
+
-
[[Categories:Hormones]]
+
[[category:Hormones]]

Current revision

Show 3-D Structure

2,3-bis(3'-hydroxybenzyl)butyrolactone
Systematic (IUPAC) name
3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one
Identifiers
CAS number  ?
ATC code  ?
PubChem 123917
Chemical data
Formula C18H18O4
Mol. mass 298.33
SMILES eMolecules & PubChem
Synonyms Enterolactone
Pharmacokinetic data
Bioavailability  ?
Metabolism  ?
Half life  ?
Excretion  ?
Therapeutic considerations
Pregnancy cat.

?

Legal status
Routes  ?

[edit] Description

lignan isolated from urine of humans and other mammals; RN given refers to cpd without isomeric designation; structure given in second source