15-Deoxy-PGJ2
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m (1 revision) |
|||
(2 intermediate revisions not shown.) | |||
Line 1: | Line 1: | ||
- | |||
- | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
- | == | + | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?&db=arun&table=nphormonet&id=1363&show=SHOW-3D Show 3-D Structure] |
+ | |||
+ | {{Drugbox | ||
+ | | IUPAC_name = (Z)-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxo-1-cyclopent-2-enyl]hept-5-enoic acid | ||
+ | | CAS_number = | ||
+ | | CAS_supplemental = | ||
+ | | ATC_suffix = | ||
+ | | ATC_supplemental = | ||
+ | | PubChem = 5311211 | ||
+ | | DrugBank = | ||
+ | | ChemSpiderID = | ||
+ | | chemical_formula = C<sub>20</sub>H<sub>28</sub>O<sub>3</sub> | ||
+ | | molecular_weight = 316.43 | ||
+ | | smiles = CCCCCC=CC=C1C(C=CC1=O)CC=CCCCC(=O)O | ||
+ | | synonyms = | ||
+ | | density = | ||
+ | | melting_point = | ||
+ | | boiling_point = | ||
+ | | solubility = | ||
+ | | specific_rotation = | ||
+ | | sec_combustion = | ||
+ | | bioavailability = | ||
+ | | protein_bound = | ||
+ | | metabolism = | ||
+ | | elimination_half-life = | ||
+ | | excretion = | ||
+ | | pregnancy_category= | ||
+ | | dependency_liability = | ||
+ | | routes_of_administration = | ||
+ | }} | ||
+ | |||
15-deoxy-PGJ2 is also available; check for double bonds (indicated by delta) at 12 and 14 positions | 15-deoxy-PGJ2 is also available; check for double bonds (indicated by delta) at 12 and 14 positions | ||
==General Properties== | ==General Properties== | ||
Line 56: | Line 84: | ||
- | [[ | + | [[Category:Hormones]] |
+ | [[Category:HMRbase]] |
Current revision
|
15-Deoxy-PGJ2
| |
Systematic (IUPAC) name | |
(Z)-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxo-1-cyclopent-2-enyl]hept-5-enoic acid | |
Identifiers | |
CAS number | ? |
ATC code | ? |
PubChem | |
Chemical data | |
Formula | C20H28O3 |
Mol. mass | 316.43 |
SMILES | & |
Pharmacokinetic data | |
Bioavailability | ? |
Metabolism | ? |
Half life | ? |
Excretion | ? |
Therapeutic considerations | |
Pregnancy cat. |
? |
Legal status | |
Routes | ? |
15-deoxy-PGJ2 is also available; check for double bonds (indicated by delta) at 12 and 14 positions
[edit] General Properties
*Molecular Weight
316.43
*Molecular Formula
C20H28O3
*IUPAC NAME
(Z)-7-[(1S,5E)-5-[(E)-oct-2-enylidene]-4-oxo-1-cyclopent-2-enyl]hept-5-enoic acid
*Canonical Smiles
CCCCCC=CC=C1C(C=CC1=O)CC=CCCCC(=O)O
*Isomeric Smiles
CCCCCC=CC=C1/[C@H](C=CC1=O)CC=C/CCCC(=O)O
[edit] PhysioChemical Properties
*Melting Point
*LogP
*Water Solubility