Flumethasone
From DrugPedia: A Wikipedia for Drug discovery
(One intermediate revision not shown.) | |||
Line 9: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
- | + | ||
- | [http:// | + | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1067&show=SHOW-3D Show 3-D Structure] |
+ | {{drugbox | | ||
+ | | IUPAC_name = (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | ||
+ | |synonyms=(6''S'',8''S'',9''S'',10''S'',11''S'',13''S'',14''S'',16''R'',17''R'')-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[''a'']phenanthren-3-one | ||
+ | | CAS_number = 2135-17-3 | ||
+ | | ATC_suffix = AB03 | ||
+ | | ATC_supplemental = {{ATC|D07|XB01}} | ||
+ | | PubChem = 16490 | ||
+ | | DrugBank = | ||
+ | | chemical_formula=C<sub>2</sub><sub>2</sub>H<sub>2</sub><sub>8</sub>F<sub>2</sub>O<sub>5</sub> | ||
+ | | molecular_weight = 410.452 g/mol | ||
+ | | bioavailability = | ||
+ | | protein_bound = | ||
+ | | metabolism = [[Liver|Hepatic]], [[CYP3A4]]-mediated | ||
+ | | elimination_half-life = | ||
+ | | excretion = | ||
+ | | pregnancy_category = | ||
+ | | legal_status = | ||
+ | | routes_of_administration = Topical | ||
+ | }} | ||
+ | '''Flumetasone''' (usually as the [[pivalic acid]] [[ester]] '''flumetasone pivalate''', trade name '''Locacorten''' or '''Locorten''') is a [[corticosteroid]] for topical use. It is available in combination with [[clioquinol]], under the trade name '''Locacorten-Vioform''' (in some countries Locorten-Vioform), for the treatment of [[otitis externa]] and [[otomycosis]]. | ||
An anti-inflammatory glucocorticoid used in veterinary practice. | An anti-inflammatory glucocorticoid used in veterinary practice. | ||
Line 56: | Line 76: | ||
- | [[ | + | [[Category:Hormones]] |
+ | [[Category:HMRbase]] |
Current revision
|
Flumethasone
| |
Systematic (IUPAC) name | |
(6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | |
Identifiers | |
CAS number | |
ATC code | ? |
PubChem | |
Chemical data | |
Formula | C22H28F2O5 |
Mol. mass | 410.452 g/mol |
Synonyms | (6S,8S,9S,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
Pharmacokinetic data | |
Bioavailability | ? |
Metabolism | Hepatic, CYP3A4-mediated |
Half life | ? |
Excretion | ? |
Therapeutic considerations | |
Pregnancy cat. |
? |
Legal status | |
Routes | Topical |
Flumetasone (usually as the pivalic acid ester flumetasone pivalate, trade name Locacorten or Locorten) is a corticosteroid for topical use. It is available in combination with clioquinol, under the trade name Locacorten-Vioform (in some countries Locorten-Vioform), for the treatment of otitis externa and otomycosis.
An anti-inflammatory glucocorticoid used in veterinary practice.
[edit] General Properties
*Molecular Weight
410.45
*Molecular Formula
C22H28F2O5
*IUPAC NAME
(6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
*Canonical Smiles
CC1CC2C3CC(C4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C)F
*Isomeric Smiles
C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C)F
[edit] PhysioChemical Properties
*Melting Point
*LogP
1.94(EXP)
*Water Solubility
1(EXP) at 20C