Flumethasone
From DrugPedia: A Wikipedia for Drug discovery
m (1 revision) |
|||
| (2 intermediate revisions not shown.) | |||
| Line 1: | Line 1: | ||
| - | |||
| - | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
| Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| - | == | + | |
| + | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1067&show=SHOW-3D Show 3-D Structure] | ||
| + | {{drugbox | | ||
| + | | IUPAC_name = (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | ||
| + | |synonyms=(6''S'',8''S'',9''S'',10''S'',11''S'',13''S'',14''S'',16''R'',17''R'')-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[''a'']phenanthren-3-one | ||
| + | | CAS_number = 2135-17-3 | ||
| + | | ATC_suffix = AB03 | ||
| + | | ATC_supplemental = {{ATC|D07|XB01}} | ||
| + | | PubChem = 16490 | ||
| + | | DrugBank = | ||
| + | | chemical_formula=C<sub>2</sub><sub>2</sub>H<sub>2</sub><sub>8</sub>F<sub>2</sub>O<sub>5</sub> | ||
| + | | molecular_weight = 410.452 g/mol | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = [[Liver|Hepatic]], [[CYP3A4]]-mediated | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category = | ||
| + | | legal_status = | ||
| + | | routes_of_administration = Topical | ||
| + | }} | ||
| + | '''Flumetasone''' (usually as the [[pivalic acid]] [[ester]] '''flumetasone pivalate''', trade name '''Locacorten''' or '''Locorten''') is a [[corticosteroid]] for topical use. It is available in combination with [[clioquinol]], under the trade name '''Locacorten-Vioform''' (in some countries Locorten-Vioform), for the treatment of [[otitis externa]] and [[otomycosis]]. | ||
| + | |||
An anti-inflammatory glucocorticoid used in veterinary practice. | An anti-inflammatory glucocorticoid used in veterinary practice. | ||
==General Properties== | ==General Properties== | ||
| Line 56: | Line 76: | ||
| - | [[ | + | [[Category:Hormones]] |
| + | [[Category:HMRbase]] | ||
Current revision
|
|
| Flumethasone
| |
| Systematic (IUPAC) name | |
| (6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | |
| Identifiers | |
| CAS number | |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C22H28F2O5 |
| Mol. mass | 410.452 g/mol |
| Synonyms | (6S,8S,9S,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | Hepatic, CYP3A4-mediated |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | Topical |
Flumetasone (usually as the pivalic acid ester flumetasone pivalate, trade name Locacorten or Locorten) is a corticosteroid for topical use. It is available in combination with clioquinol, under the trade name Locacorten-Vioform (in some countries Locorten-Vioform), for the treatment of otitis externa and otomycosis.
An anti-inflammatory glucocorticoid used in veterinary practice.
[edit] General Properties
*Molecular Weight
410.45
*Molecular Formula
C22H28F2O5
*IUPAC NAME
(6S,8S,9R,10S,11S,13S,14S,16R,17R)-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one
*Canonical Smiles
CC1CC2C3CC(C4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C)F
*Isomeric Smiles
C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C)F
[edit] PhysioChemical Properties
*Melting Point
*LogP
1.94(EXP)
*Water Solubility
1(EXP) at 20C
