View source

[http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1001&show=SHOW-3D Show 3-D Structure]
{{Drugbox
| IUPAC_name        = 3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one
| CAS_number        = 
| CAS_supplemental  = 
| ATC_suffix = BA03
| ATC_supplemental  = 
| PubChem           = 123917
| ChemSpiderID      = 
| chemical_formula  =C<sub>18</sub>H<sub>18</sub>O<sub>4</sub>
| molecular_weight  = 298.33
| smiles            = C1C(C(C(=O)O1)CC2=CC(=CC=C2)O)CC3=CC(=CC=C3)O
| synonyms          = Enterolactone
| density           = 
| melting_point     = 
| boiling_point     = 
| solubility        = 
| specific_rotation = 
| sec_combustion    = 
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 
| excretion         = 
| pregnancy_category= 
| dependency_liability = 
| routes_of_administration =
}}
==Description==
lignan isolated from urine of humans and other mammals; RN given refers to cpd without isomeric designation; structure given in second source

[[category:Hormones]]